About 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol
6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 117275811) has the molecular formula C6H4BrN3O
and a molecular weight of 214.02 g/mol. Its IUPAC name is 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| PubChem CID | 117275811 |
| Molecular Formula | C6H4BrN3O |
| Molecular Weight | 214.02 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | Oc1cc(Br)cn2ncnc12 |
| InChI | InChI=1S/C6H4BrN3O/c7-4-1-5(11)6-8-3-9-10(6)2-4/h1-3,11H |
| InChIKey | OKXQGEZKVBYPJU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.02 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol?
The IUPAC name of 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol (CID 117275811) is 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
What is the SMILES notation for 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol?
The canonical SMILES for 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol is Oc1cc(Br)cn2ncnc12.
What is the InChIKey of 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol?
The InChIKey is OKXQGEZKVBYPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O/c7-4-1-5(11)6-8-3-9-10(6)2-4/h1-3,11H.
What are the key properties of 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol?
6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol has a molecular weight of 214.02 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-8-ol is sourced from PubChem (CID 117275811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).