About 3-acetyl-4,5-dimethylbenzonitrile
3-acetyl-4,5-dimethylbenzonitrile (PubChem CID 117277025) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-acetyl-4,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 3-acetyl-4,5-dimethylbenzonitrile |
| PubChem CID | 117277025 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-acetyl-4,5-dimethylbenzonitrile |
| SMILES | CC(=O)c1cc(C#N)cc(C)c1C |
| InChI | InChI=1S/C11H11NO/c1-7-4-10(6-12)5-11(8(7)2)9(3)13/h4-5H,1-3H3 |
| InChIKey | WSDWNZLRWLJSAQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-acetyl-4,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4,5-dimethylbenzonitrile?
The IUPAC name of 3-acetyl-4,5-dimethylbenzonitrile (CID 117277025) is 3-acetyl-4,5-dimethylbenzonitrile.
What is the SMILES notation for 3-acetyl-4,5-dimethylbenzonitrile?
The canonical SMILES for 3-acetyl-4,5-dimethylbenzonitrile is CC(=O)c1cc(C#N)cc(C)c1C.
What is the InChIKey of 3-acetyl-4,5-dimethylbenzonitrile?
The InChIKey is WSDWNZLRWLJSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-7-4-10(6-12)5-11(8(7)2)9(3)13/h4-5H,1-3H3.
What are the key properties of 3-acetyl-4,5-dimethylbenzonitrile?
3-acetyl-4,5-dimethylbenzonitrile has a molecular weight of 173.21 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4,5-dimethylbenzonitrile is sourced from PubChem (CID 117277025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).