About 3-(1-aminoethyl)-4,5-dimethylbenzonitrile
3-(1-aminoethyl)-4,5-dimethylbenzonitrile (PubChem CID 117277134) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 3-(1-aminoethyl)-4,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 3-(1-aminoethyl)-4,5-dimethylbenzonitrile |
| PubChem CID | 117277134 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-(1-aminoethyl)-4,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C(C)N)c1C |
| InChI | InChI=1S/C11H14N2/c1-7-4-10(6-12)5-11(8(7)2)9(3)13/h4-5,9H,13H2,1-3H3 |
| InChIKey | NUIIWYZLDXOGQF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-aminoethyl)-4,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminoethyl)-4,5-dimethylbenzonitrile?
The IUPAC name of 3-(1-aminoethyl)-4,5-dimethylbenzonitrile (CID 117277134) is 3-(1-aminoethyl)-4,5-dimethylbenzonitrile.
What is the SMILES notation for 3-(1-aminoethyl)-4,5-dimethylbenzonitrile?
The canonical SMILES for 3-(1-aminoethyl)-4,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C(C)N)c1C.
What is the InChIKey of 3-(1-aminoethyl)-4,5-dimethylbenzonitrile?
The InChIKey is NUIIWYZLDXOGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-7-4-10(6-12)5-11(8(7)2)9(3)13/h4-5,9H,13H2,1-3H3.
What are the key properties of 3-(1-aminoethyl)-4,5-dimethylbenzonitrile?
3-(1-aminoethyl)-4,5-dimethylbenzonitrile has a molecular weight of 174.25 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminoethyl)-4,5-dimethylbenzonitrile is sourced from PubChem (CID 117277134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).