About 2-(aminooxymethyl)-4,6-difluorophenol
2-(aminooxymethyl)-4,6-difluorophenol (PubChem CID 117277154) has the molecular formula C7H7F2NO2
and a molecular weight of 175.13 g/mol. Its IUPAC name is 2-(aminooxymethyl)-4,6-difluorophenol.
Molecular Properties
| Compound Name | 2-(aminooxymethyl)-4,6-difluorophenol |
| PubChem CID | 117277154 |
| Molecular Formula | C7H7F2NO2 |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-(aminooxymethyl)-4,6-difluorophenol |
| SMILES | NOCc1cc(F)cc(F)c1O |
| InChI | InChI=1S/C7H7F2NO2/c8-5-1-4(3-12-10)7(11)6(9)2-5/h1-2,11H,3,10H2 |
| InChIKey | BGVLOSDAUWIGQL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminooxymethyl)-4,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminooxymethyl)-4,6-difluorophenol?
The IUPAC name of 2-(aminooxymethyl)-4,6-difluorophenol (CID 117277154) is 2-(aminooxymethyl)-4,6-difluorophenol.
What is the SMILES notation for 2-(aminooxymethyl)-4,6-difluorophenol?
The canonical SMILES for 2-(aminooxymethyl)-4,6-difluorophenol is NOCc1cc(F)cc(F)c1O.
What is the InChIKey of 2-(aminooxymethyl)-4,6-difluorophenol?
The InChIKey is BGVLOSDAUWIGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO2/c8-5-1-4(3-12-10)7(11)6(9)2-5/h1-2,11H,3,10H2.
What are the key properties of 2-(aminooxymethyl)-4,6-difluorophenol?
2-(aminooxymethyl)-4,6-difluorophenol has a molecular weight of 175.13 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminooxymethyl)-4,6-difluorophenol is sourced from PubChem (CID 117277154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).