C15H25NO8 — CID 11727728
ethyl (2R,3R)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[formyl(methyl)amino]-3-hydroxypropanoate (PubChem CID 11727728) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[formyl(methyl)amino]-3-hydroxypropanoate.
| Compound Name | ethyl (2R,3R)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[formyl(methyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 11727728 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl (2R,3R)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[formyl(methyl)amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@H]([C@@H](O)[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@H]12)N(C)C=O |
| InChI | InChI=1S/C15H25NO8/c1-6-21-13(19)8(16(4)7-17)9(18)10-11-12(14(20-5)22-10)24-15(2,3)23-11/h7-12,14,18H,6H2,1-5H3/t8-,9-,10-,11-,12-,14-/m1/s1 |
| InChIKey | GIXPCMUBFKGPIL-HXZMXFDXSA-N |
| XLogP | -0.74 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|