C21H34O4 — CID 11727833
[(1R,3S,5R,8aR)-8a-methyl-3-(oxan-2-yloxy)-1-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-azulen-5-yl] acetate (PubChem CID 11727833) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(1R,3S,5R,8aR)-8a-methyl-3-(oxan-2-yloxy)-1-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-azulen-5-yl] acetate.
| Compound Name | [(1R,3S,5R,8aR)-8a-methyl-3-(oxan-2-yloxy)-1-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-azulen-5-yl] acetate |
|---|---|
| PubChem CID | 11727833 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | [(1R,3S,5R,8aR)-8a-methyl-3-(oxan-2-yloxy)-1-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-azulen-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2[C@@H](OC3CCCCO3)C[C@H](C(C)C)[C@@]2(C)CCC1 |
| InChI | InChI=1S/C21H34O4/c1-14(2)17-13-19(25-20-9-5-6-11-23-20)18-12-16(24-15(3)22)8-7-10-21(17,18)4/h12,14,16-17,19-20H,5-11,13H2,1-4H3/t16-,17-,19+,20?,21-/m1/s1 |
| InChIKey | XMLOQUYHGPAVEC-YMXJLETBSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|