About O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine
O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine (PubChem CID 117278658) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine.
Molecular Properties
| Compound Name | O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine |
| PubChem CID | 117278658 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine |
| SMILES | NOCc1ccc2snnc2c1 |
| InChI | InChI=1S/C7H7N3OS/c8-11-4-5-1-2-7-6(3-5)9-10-12-7/h1-3H,4,8H2 |
| InChIKey | LLJWYWROFOVJAY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine?
The IUPAC name of O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine (CID 117278658) is O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine.
What is the SMILES notation for O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine?
The canonical SMILES for O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine is NOCc1ccc2snnc2c1.
What is the InChIKey of O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine?
The InChIKey is LLJWYWROFOVJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c8-11-4-5-1-2-7-6(3-5)9-10-12-7/h1-3H,4,8H2.
What are the key properties of O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine?
O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine has a molecular weight of 181.22 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1,2,3-benzothiadiazol-5-ylmethyl)hydroxylamine is sourced from PubChem (CID 117278658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).