C20H19NO3S — CID 11727927
[(4S,5S)-2-(2-methylsulfanylphenyl)-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl prop-2-enoate (PubChem CID 11727927) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is [(4S,5S)-2-(2-methylsulfanylphenyl)-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl prop-2-enoate.
| Compound Name | [(4S,5S)-2-(2-methylsulfanylphenyl)-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 11727927 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [(4S,5S)-2-(2-methylsulfanylphenyl)-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H]1N=C(c2ccccc2SC)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO3S/c1-3-18(22)23-13-16-19(14-9-5-4-6-10-14)24-20(21-16)15-11-7-8-12-17(15)25-2/h3-12,16,19H,1,13H2,2H3/t16-,19-/m0/s1 |
| InChIKey | PBTZFHCOABNNOZ-LPHOPBHVSA-N |
| XLogP | 4.02 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|