C17H23NO3S2 — CID 11727932
(1S,5R,7R)-10,10-dimethyl-4-[(R)-(4-methylphenyl)sulfinyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 11727932) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (1S,5R,7R)-10,10-dimethyl-4-[(R)-(4-methylphenyl)sulfinyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | (1S,5R,7R)-10,10-dimethyl-4-[(R)-(4-methylphenyl)sulfinyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 11727932 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (1S,5R,7R)-10,10-dimethyl-4-[(R)-(4-methylphenyl)sulfinyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | Cc1ccc([S@@](=O)N2[C@@H]3C[C@H]4CC[C@]3(CS2(=O)=O)C4(C)C)cc1 |
| InChI | InChI=1S/C17H23NO3S2/c1-12-4-6-14(7-5-12)22(19)18-15-10-13-8-9-17(15,16(13,2)3)11-23(18,20)21/h4-7,13,15H,8-11H2,1-3H3/t13-,15-,17-,22-/m1/s1 |
| InChIKey | KOSWKEHGRFHJEO-DKNRHBQSSA-N |
| XLogP | 2.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |