About 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol
1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol (PubChem CID 117281567) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol.
Molecular Properties
| Compound Name | 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol |
| PubChem CID | 117281567 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol |
| SMILES | CN1CCc2cccc(C3(O)CC3)c21 |
| InChI | InChI=1S/C12H15NO/c1-13-8-5-9-3-2-4-10(11(9)13)12(14)6-7-12/h2-4,14H,5-8H2,1H3 |
| InChIKey | WJLDISRTFJVVBG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol?
The IUPAC name of 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol (CID 117281567) is 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol.
What is the SMILES notation for 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol?
The canonical SMILES for 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol is CN1CCc2cccc(C3(O)CC3)c21.
What is the InChIKey of 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol?
The InChIKey is WJLDISRTFJVVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-13-8-5-9-3-2-4-10(11(9)13)12(14)6-7-12/h2-4,14H,5-8H2,1H3.
What are the key properties of 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol?
1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol has a molecular weight of 189.26 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-2,3-dihydroindol-7-yl)cyclopropan-1-ol is sourced from PubChem (CID 117281567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).