About 7-(isocyanatomethyl)-1,2-benzothiazole
7-(isocyanatomethyl)-1,2-benzothiazole (PubChem CID 117281804) has the molecular formula C9H6N2OS
and a molecular weight of 190.23 g/mol. Its IUPAC name is 7-(isocyanatomethyl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 7-(isocyanatomethyl)-1,2-benzothiazole |
| PubChem CID | 117281804 |
| Molecular Formula | C9H6N2OS |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 7-(isocyanatomethyl)-1,2-benzothiazole |
| SMILES | O=C=NCc1cccc2cnsc12 |
| InChI | InChI=1S/C9H6N2OS/c12-6-10-4-7-2-1-3-8-5-11-13-9(7)8/h1-3,5H,4H2 |
| InChIKey | UAOJVTPHWLWNMD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-(isocyanatomethyl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(isocyanatomethyl)-1,2-benzothiazole?
The IUPAC name of 7-(isocyanatomethyl)-1,2-benzothiazole (CID 117281804) is 7-(isocyanatomethyl)-1,2-benzothiazole.
What is the SMILES notation for 7-(isocyanatomethyl)-1,2-benzothiazole?
The canonical SMILES for 7-(isocyanatomethyl)-1,2-benzothiazole is O=C=NCc1cccc2cnsc12.
What is the InChIKey of 7-(isocyanatomethyl)-1,2-benzothiazole?
The InChIKey is UAOJVTPHWLWNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2OS/c12-6-10-4-7-2-1-3-8-5-11-13-9(7)8/h1-3,5H,4H2.
What are the key properties of 7-(isocyanatomethyl)-1,2-benzothiazole?
7-(isocyanatomethyl)-1,2-benzothiazole has a molecular weight of 190.23 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(isocyanatomethyl)-1,2-benzothiazole is sourced from PubChem (CID 117281804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).