C12H14O2 — CID 117281892
3-(1,3-dihydro-2-benzofuran-4-yl)butanal (PubChem CID 117281892) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-(1,3-dihydro-2-benzofuran-4-yl)butanal.
| Compound Name | 3-(1,3-dihydro-2-benzofuran-4-yl)butanal |
|---|---|
| PubChem CID | 117281892 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-(1,3-dihydro-2-benzofuran-4-yl)butanal |
| SMILES | CC(CC=O)c1cccc2c1COC2 |
| InChI | InChI=1S/C12H14O2/c1-9(5-6-13)11-4-2-3-10-7-14-8-12(10)11/h2-4,6,9H,5,7-8H2,1H3 |
| InChIKey | YHTQOHZQUJBWID-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|