C13H18O — CID 117282016
1-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanol (PubChem CID 117282016) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanol.
| Compound Name | 1-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 117282016 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanol |
| SMILES | Cc1ccc(C(C)O)c2c1CCCC2 |
| InChI | InChI=1S/C13H18O/c1-9-7-8-12(10(2)14)13-6-4-3-5-11(9)13/h7-8,10,14H,3-6H2,1-2H3 |
| InChIKey | VJOHZFBEXUAZNK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |