C11H13NO2 — CID 117282271
3-(2-methyl-1,3-benzoxazol-4-yl)propan-1-ol (PubChem CID 117282271) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzoxazol-4-yl)propan-1-ol.
| Compound Name | 3-(2-methyl-1,3-benzoxazol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 117282271 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-(2-methyl-1,3-benzoxazol-4-yl)propan-1-ol |
| SMILES | Cc1nc2c(CCCO)cccc2o1 |
| InChI | InChI=1S/C11H13NO2/c1-8-12-11-9(5-3-7-13)4-2-6-10(11)14-8/h2,4,6,13H,3,5,7H2,1H3 |
| InChIKey | FUUPTCPYSZVNQE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |