About 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol
2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol (PubChem CID 117282353) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol |
| PubChem CID | 117282353 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol |
| SMILES | Cc1noc2cc(C(C)(C)O)ccc12 |
| InChI | InChI=1S/C11H13NO2/c1-7-9-5-4-8(11(2,3)13)6-10(9)14-12-7/h4-6,13H,1-3H3 |
| InChIKey | MHYPUWSLZFQQLW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol?
The IUPAC name of 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol (CID 117282353) is 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol.
What is the SMILES notation for 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol?
The canonical SMILES for 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol is Cc1noc2cc(C(C)(C)O)ccc12.
What is the InChIKey of 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol?
The InChIKey is MHYPUWSLZFQQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-7-9-5-4-8(11(2,3)13)6-10(9)14-12-7/h4-6,13H,1-3H3.
What are the key properties of 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol?
2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol has a molecular weight of 191.23 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-benzoxazol-6-yl)propan-2-ol is sourced from PubChem (CID 117282353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).