C20H23N5O2 — CID 11728238
2-[(E)-[(1S,7aR)-1-[(1,3-dioxoisoindol-2-yl)methyl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-ylidene]amino]guanidine (PubChem CID 11728238) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[(E)-[(1S,7aR)-1-[(1,3-dioxoisoindol-2-yl)methyl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(1S,7aR)-1-[(1,3-dioxoisoindol-2-yl)methyl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 11728238 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[(E)-[(1S,7aR)-1-[(1,3-dioxoisoindol-2-yl)methyl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-ylidene]amino]guanidine |
| SMILES | C[C@]12CC/C(=N\N=C(N)N)C=C1CC[C@@H]2CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H23N5O2/c1-20-9-8-14(23-24-19(21)22)10-12(20)6-7-13(20)11-25-17(26)15-4-2-3-5-16(15)18(25)27/h2-5,10,13H,6-9,11H2,1H3,(H4,21,22,24)/b23-14+/t13-,20+/m1/s1 |
| InChIKey | NHANKAOOZAKQRJ-LRDFWHPZSA-N |
| XLogP | 2.05 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|