About 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile
2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile (PubChem CID 117282448) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile |
| PubChem CID | 117282448 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile |
| SMILES | CC1(C)Oc2cc(C#N)ccc2S1 |
| InChI | InChI=1S/C10H9NOS/c1-10(2)12-8-5-7(6-11)3-4-9(8)13-10/h3-5H,1-2H3 |
| InChIKey | NORQCOMRAYKMEU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile?
The IUPAC name of 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile (CID 117282448) is 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile.
What is the SMILES notation for 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile?
The canonical SMILES for 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile is CC1(C)Oc2cc(C#N)ccc2S1.
What is the InChIKey of 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile?
The InChIKey is NORQCOMRAYKMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c1-10(2)12-8-5-7(6-11)3-4-9(8)13-10/h3-5H,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile?
2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile has a molecular weight of 191.25 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-benzoxathiole-6-carbonitrile is sourced from PubChem (CID 117282448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).