C12H17NO — CID 117282545
4-(1-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 117282545) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(1-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-(1-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 117282545 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(1-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CC(N)c1ccc(O)c2c1CCCC2 |
| InChI | InChI=1S/C12H17NO/c1-8(13)9-6-7-12(14)11-5-3-2-4-10(9)11/h6-8,14H,2-5,13H2,1H3 |
| InChIKey | NCTYTSONPLILGH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |