C11H15NO2 — CID 117283565
2-(pyrrolidin-2-ylmethyl)benzene-1,4-diol (PubChem CID 117283565) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(pyrrolidin-2-ylmethyl)benzene-1,4-diol.
| Compound Name | 2-(pyrrolidin-2-ylmethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 117283565 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(pyrrolidin-2-ylmethyl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CC2CCCN2)c1 |
| InChI | InChI=1S/C11H15NO2/c13-10-3-4-11(14)8(7-10)6-9-2-1-5-12-9/h3-4,7,9,12-14H,1-2,5-6H2 |
| InChIKey | GUPPCCHJFMHWTD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|