C12H19NO — CID 117284105
2-(6-methoxy-2,3-dimethylphenyl)propan-1-amine (PubChem CID 117284105) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(6-methoxy-2,3-dimethylphenyl)propan-1-amine.
| Compound Name | 2-(6-methoxy-2,3-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117284105 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(6-methoxy-2,3-dimethylphenyl)propan-1-amine |
| SMILES | COc1ccc(C)c(C)c1C(C)CN |
| InChI | InChI=1S/C12H19NO/c1-8-5-6-11(14-4)12(10(8)3)9(2)7-13/h5-6,9H,7,13H2,1-4H3 |
| InChIKey | LOXXFGAYXJFYOC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |