About O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine
O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine (PubChem CID 117284726) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine |
| PubChem CID | 117284726 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1cccc2cnsc12 |
| InChI | InChI=1S/C9H10N2OS/c10-12-5-4-7-2-1-3-8-6-11-13-9(7)8/h1-3,6H,4-5,10H2 |
| InChIKey | SGMVAUUXCCVBAW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine?
The IUPAC name of O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine (CID 117284726) is O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine.
What is the SMILES notation for O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine?
The canonical SMILES for O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine is NOCCc1cccc2cnsc12.
What is the InChIKey of O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine?
The InChIKey is SGMVAUUXCCVBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c10-12-5-4-7-2-1-3-8-6-11-13-9(7)8/h1-3,6H,4-5,10H2.
What are the key properties of O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine?
O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine has a molecular weight of 194.26 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(1,2-benzothiazol-7-yl)ethyl]hydroxylamine is sourced from PubChem (CID 117284726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).