C11H14FNO — CID 117285258
4-[1-(1-aminoethyl)cyclopropyl]-2-fluorophenol (PubChem CID 117285258) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-[1-(1-aminoethyl)cyclopropyl]-2-fluorophenol.
| Compound Name | 4-[1-(1-aminoethyl)cyclopropyl]-2-fluorophenol |
|---|---|
| PubChem CID | 117285258 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-[1-(1-aminoethyl)cyclopropyl]-2-fluorophenol |
| SMILES | CC(N)C1(c2ccc(O)c(F)c2)CC1 |
| InChI | InChI=1S/C11H14FNO/c1-7(13)11(4-5-11)8-2-3-10(14)9(12)6-8/h2-3,6-7,14H,4-5,13H2,1H3 |
| InChIKey | OHFBJNTYPNCECS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |