C19H28O8 — CID 11728713
methyl (2E)-2-[(3aR,6S,6aR)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate (PubChem CID 11728713) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl (2E)-2-[(3aR,6S,6aR)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3aR,6S,6aR)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
|---|---|
| PubChem CID | 11728713 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl (2E)-2-[(3aR,6S,6aR)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
| SMILES | C=CCO[C@@H]([C@@H]1O/C(=C/C(=O)OC)[C@@H]2OC(C)(C)O[C@H]12)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H28O8/c1-7-8-22-14(12-10-23-18(2,3)25-12)16-17-15(26-19(4,5)27-17)11(24-16)9-13(20)21-6/h7,9,12,14-17H,1,8,10H2,2-6H3/b11-9+/t12-,14-,15+,16+,17+/m1/s1 |
| InChIKey | XLRIUXXEYQVVPN-FYEOQUSHSA-N |
| XLogP | 1.68 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|