About N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine
N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine (PubChem CID 117288181) has the molecular formula C9H7F2NO2
and a molecular weight of 199.16 g/mol. Its IUPAC name is N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine |
| PubChem CID | 117288181 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine |
| SMILES | ONCc1c(F)cc(F)c2ccoc12 |
| InChI | InChI=1S/C9H7F2NO2/c10-7-3-8(11)6(4-12-13)9-5(7)1-2-14-9/h1-3,12-13H,4H2 |
| InChIKey | VHIIPXQRTCHJLB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine?
The IUPAC name of N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine (CID 117288181) is N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine.
What is the SMILES notation for N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine?
The canonical SMILES for N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine is ONCc1c(F)cc(F)c2ccoc12.
What is the InChIKey of N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine?
The InChIKey is VHIIPXQRTCHJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2NO2/c10-7-3-8(11)6(4-12-13)9-5(7)1-2-14-9/h1-3,12-13H,4H2.
What are the key properties of N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine?
N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine has a molecular weight of 199.16 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-difluoro-1-benzofuran-7-yl)methyl]hydroxylamine is sourced from PubChem (CID 117288181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).