About N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide
N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide (PubChem CID 1172883) has the molecular formula C20H27N3O3S2
and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide |
| PubChem CID | 1172883 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(NC(=S)NCC(C)C)c(OCC)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-5-25-16-11-15(23-20(27)21-12-13(3)4)17(26-6-2)10-14(16)22-19(24)18-8-7-9-28-18/h7-11,13H,5-6,12H2,1-4H3,(H,22,24)(H2,21,23,27) |
| InChIKey | LACUECCYMJPJCM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide (CID 1172883) is N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide is CCOc1cc(NC(=S)NCC(C)C)c(OCC)cc1NC(=O)c1cccs1.
What is the InChIKey of N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide?
The InChIKey is LACUECCYMJPJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O3S2/c1-5-25-16-11-15(23-20(27)21-12-13(3)4)17(26-6-2)10-14(16)22-19(24)18-8-7-9-28-18/h7-11,13H,5-6,12H2,1-4H3,(H,22,24)(H2,21,23,27).
What are the key properties of N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide?
N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide has a molecular weight of 421.59 g/mol, XLogP of 4.74, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-diethoxy-4-(2-methylpropylcarbamothioylamino)phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 1172883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).