About 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]
5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] (PubChem CID 11728918) has the molecular formula C15H19BrN+
and a molecular weight of 293.23 g/mol. Its IUPAC name is 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium].
Molecular Properties
| Compound Name | 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] |
| PubChem CID | 11728918 |
| Molecular Formula | C15H19BrN+ |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] |
| SMILES | CC1=[N+](C)c2ccc(Br)cc2C12CCCCC2 |
| InChI | InChI=1S/C15H19BrN/c1-11-15(8-4-3-5-9-15)13-10-12(16)6-7-14(13)17(11)2/h6-7,10H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | PIKMZQFFKDAKOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]?
The IUPAC name of 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] (CID 11728918) is 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium].
What is the SMILES notation for 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]?
The canonical SMILES for 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] is CC1=[N+](C)c2ccc(Br)cc2C12CCCCC2.
What is the InChIKey of 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]?
The InChIKey is PIKMZQFFKDAKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN/c1-11-15(8-4-3-5-9-15)13-10-12(16)6-7-14(13)17(11)2/h6-7,10H,3-5,8-9H2,1-2H3/q+1.
What are the key properties of 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]?
5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] has a molecular weight of 293.23 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] is sourced from PubChem (CID 11728918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).