C15H19BrN+ — CID 11728918
5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] (PubChem CID 11728918) has the molecular formula C15H19BrN+ and a molecular weight of 293.23 g/mol. Its IUPAC name is 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium].
| Compound Name | 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] |
|---|---|
| PubChem CID | 11728918 |
| Molecular Formula | C15H19BrN+ |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5'-bromo-1',2'-dimethylspiro[cyclohexane-1,3'-indol-1-ium] |
| SMILES | CC1=[N+](C)c2ccc(Br)cc2C12CCCCC2 |
| InChI | InChI=1S/C15H19BrN/c1-11-15(8-4-3-5-9-15)13-10-12(16)6-7-14(13)17(11)2/h6-7,10H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | PIKMZQFFKDAKOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|