C20H26O3Se — CID 11728926
(3'aS,7'S,7'aS)-3'a,7',7'a-trimethyl-2'-phenylselanylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-one (PubChem CID 11728926) has the molecular formula C20H26O3Se and a molecular weight of 393.39 g/mol. Its IUPAC name is (3'aS,7'S,7'aS)-3'a,7',7'a-trimethyl-2'-phenylselanylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-one.
| Compound Name | (3'aS,7'S,7'aS)-3'a,7',7'a-trimethyl-2'-phenylselanylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-one |
|---|---|
| PubChem CID | 11728926 |
| Molecular Formula | C20H26O3Se |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (3'aS,7'S,7'aS)-3'a,7',7'a-trimethyl-2'-phenylselanylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-one |
| SMILES | C[C@@H]1C2(CC[C@@]3(C)CC([Se]c4ccccc4)C(=O)[C@@]13C)OCCO2 |
| InChI | InChI=1S/C20H26O3Se/c1-14-19(3)17(21)16(24-15-7-5-4-6-8-15)13-18(19,2)9-10-20(14)22-11-12-23-20/h4-8,14,16H,9-13H2,1-3H3/t14-,16?,18-,19+/m0/s1 |
| InChIKey | QWPFPJOLXKCXMH-NMACRGETSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|