C20H29NO5S — CID 11728973
(2R,4R)-2-(4-hydroxybutoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 11728973) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is (2R,4R)-2-(4-hydroxybutoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-(4-hydroxybutoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 11728973 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2R,4R)-2-(4-hydroxybutoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)C1=C[C@H](c2ccsc2)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C20H29NO5S/c22-8-3-4-9-25-19-12-15(14-7-10-27-13-14)11-18(26-19)20(24)21-16-5-1-2-6-17(16)23/h7,10-11,13,15-17,19,22-23H,1-6,8-9,12H2,(H,21,24)/t15-,16-,17-,19+/m0/s1 |
| InChIKey | LDILBVYNOGCNCY-LSTDLKDCSA-N |
| XLogP | 2.67 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|