About 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine
4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine (PubChem CID 117289787) has the molecular formula C10H7N3O2
and a molecular weight of 201.19 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine |
| PubChem CID | 117289787 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1ccc2ocnc2c1 |
| InChI | InChI=1S/C10H7N3O2/c11-10-7(4-13-15-10)6-1-2-9-8(3-6)12-5-14-9/h1-5H,11H2 |
| InChIKey | DMYNCDVVOZFRQN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine?
The IUPAC name of 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine (CID 117289787) is 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine.
What is the SMILES notation for 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine?
The canonical SMILES for 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine is Nc1oncc1-c1ccc2ocnc2c1.
What is the InChIKey of 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine?
The InChIKey is DMYNCDVVOZFRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O2/c11-10-7(4-13-15-10)6-1-2-9-8(3-6)12-5-14-9/h1-5H,11H2.
What are the key properties of 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine?
4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine has a molecular weight of 201.19 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-5-yl)-1,2-oxazol-5-amine is sourced from PubChem (CID 117289787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).