C26H20O4 — CID 11728987
11-butyl-2,7-dihydroxybenzo[b]triphenylene-9,14-dione (PubChem CID 11728987) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is 11-butyl-2,7-dihydroxybenzo[b]triphenylene-9,14-dione.
| Compound Name | 11-butyl-2,7-dihydroxybenzo[b]triphenylene-9,14-dione |
|---|---|
| PubChem CID | 11728987 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 11-butyl-2,7-dihydroxybenzo[b]triphenylene-9,14-dione |
| SMILES | CCCCc1ccc2c(c1)C(=O)c1c(c3cc(O)ccc3c3ccc(O)cc13)C2=O |
| InChI | InChI=1S/C26H20O4/c1-2-3-4-14-5-8-19-22(11-14)26(30)24-21-13-16(28)7-10-18(21)17-9-6-15(27)12-20(17)23(24)25(19)29/h5-13,27-28H,2-4H2,1H3 |
| InChIKey | OBSKYSLNCZONGS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|