C23H28FNO4 — CID 11729093
N-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 11729093) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is N-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 11729093 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | CC1(C)O[C@H]2O[C@H](CNCCc3ccccc3F)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C23H28FNO4/c1-23(2)28-21-20(26-15-16-8-4-3-5-9-16)19(27-22(21)29-23)14-25-13-12-17-10-6-7-11-18(17)24/h3-11,19-22,25H,12-15H2,1-2H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | SKUZKHAIQJSRRM-CIAFKFPVSA-N |
| XLogP | 3.42 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|