C25H26N2OS — CID 11729115
(1S,13R,14E)-14-ethylidene-16-(2-phenylsulfanylethyl)-10,16-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2,4,6,8-tetraen-11-one (PubChem CID 11729115) has the molecular formula C25H26N2OS and a molecular weight of 402.56 g/mol. Its IUPAC name is (1S,13R,14E)-14-ethylidene-16-(2-phenylsulfanylethyl)-10,16-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2,4,6,8-tetraen-11-one.
| Compound Name | (1S,13R,14E)-14-ethylidene-16-(2-phenylsulfanylethyl)-10,16-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2,4,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 11729115 |
| Molecular Formula | C25H26N2OS |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (1S,13R,14E)-14-ethylidene-16-(2-phenylsulfanylethyl)-10,16-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2,4,6,8-tetraen-11-one |
| SMILES | C/C=C1/CN(CCSc2ccccc2)[C@H]2C[C@@H]1CC(=O)n1c2cc2ccccc21 |
| InChI | InChI=1S/C25H26N2OS/c1-2-18-17-26(12-13-29-21-9-4-3-5-10-21)23-15-20(18)16-25(28)27-22-11-7-6-8-19(22)14-24(23)27/h2-11,14,20,23H,12-13,15-17H2,1H3/b18-2-/t20-,23+/m1/s1 |
| InChIKey | UHEWTZVVACHOOP-CLYFBZTCSA-N |
| XLogP | 5.79 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|