C24H38O3Si — CID 11729118
(1S,3aS,5S,7aR)-5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde (PubChem CID 11729118) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is (1S,3aS,5S,7aR)-5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde.
| Compound Name | (1S,3aS,5S,7aR)-5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 11729118 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (1S,3aS,5S,7aR)-5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc([C@H]2CC[C@]3(C)[C@@H](C=O)CC[C@]3(O)C2)cc1 |
| InChI | InChI=1S/C24H38O3Si/c1-22(2,3)28(5,6)27-17-18-7-9-19(10-8-18)20-11-13-23(4)21(16-25)12-14-24(23,26)15-20/h7-10,16,20-21,26H,11-15,17H2,1-6H3/t20-,21+,23+,24-/m0/s1 |
| InChIKey | UFDRGGIRTJADJG-SCDRESIJSA-N |
| XLogP | 5.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|