C21H18N4O5 — CID 11729193
21-[2-(dimethylamino)ethyl]-15-nitro-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one (PubChem CID 11729193) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 21-[2-(dimethylamino)ethyl]-15-nitro-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one.
| Compound Name | 21-[2-(dimethylamino)ethyl]-15-nitro-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
|---|---|
| PubChem CID | 11729193 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 21-[2-(dimethylamino)ethyl]-15-nitro-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
| SMILES | CN(C)CCn1c(=O)c2cccc([N+](=O)[O-])c2c2cnc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C21H18N4O5/c1-23(2)6-7-24-20-13-8-17-18(30-11-29-17)9-15(13)22-10-14(20)19-12(21(24)26)4-3-5-16(19)25(27)28/h3-5,8-10H,6-7,11H2,1-2H3 |
| InChIKey | RNWGIKJBCNJMQN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|