About hydrogen sulfate;2,4,6-triphenylpyrylium
hydrogen sulfate;2,4,6-triphenylpyrylium (PubChem CID 11729198) has the molecular formula C23H18O5S
and a molecular weight of 406.46 g/mol. Its IUPAC name is hydrogen sulfate;2,4,6-triphenylpyrylium.
Molecular Properties
| Compound Name | hydrogen sulfate;2,4,6-triphenylpyrylium |
| PubChem CID | 11729198 |
| Molecular Formula | C23H18O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | hydrogen sulfate;2,4,6-triphenylpyrylium |
| SMILES | O=S(=O)([O-])O.c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H17O.H2O4S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;1-5(2,3)4/h1-17H;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | IPEOZISWOGHJJY-UHFFFAOYSA-M |
| XLogP | 5.57 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfate;2,4,6-triphenylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfate;2,4,6-triphenylpyrylium?
The IUPAC name of hydrogen sulfate;2,4,6-triphenylpyrylium (CID 11729198) is hydrogen sulfate;2,4,6-triphenylpyrylium.
What is the SMILES notation for hydrogen sulfate;2,4,6-triphenylpyrylium?
The canonical SMILES for hydrogen sulfate;2,4,6-triphenylpyrylium is O=S(=O)([O-])O.c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.
What is the InChIKey of hydrogen sulfate;2,4,6-triphenylpyrylium?
The InChIKey is IPEOZISWOGHJJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H17O.H2O4S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;1-5(2,3)4/h1-17H;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of hydrogen sulfate;2,4,6-triphenylpyrylium?
hydrogen sulfate;2,4,6-triphenylpyrylium has a molecular weight of 406.46 g/mol, XLogP of 5.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;2,4,6-triphenylpyrylium is sourced from PubChem (CID 11729198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).