C24H42O3Si — CID 11729207
(3S,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-7-phenylmethoxynonanal (PubChem CID 11729207) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (3S,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-7-phenylmethoxynonanal.
| Compound Name | (3S,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-7-phenylmethoxynonanal |
|---|---|
| PubChem CID | 11729207 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (3S,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-7-phenylmethoxynonanal |
| SMILES | CC(C)[C@H](OCc1ccccc1)[C@@H](C)CC[C@@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O3Si/c1-19(2)23(26-18-21-12-10-9-11-13-21)20(3)14-15-22(16-17-25)27-28(7,8)24(4,5)6/h9-13,17,19-20,22-23H,14-16,18H2,1-8H3/t20-,22-,23-/m0/s1 |
| InChIKey | HLLULIGHJQYQCJ-PMVMPFDFSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|