About 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol
2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol (PubChem CID 117292479) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol |
| PubChem CID | 117292479 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2cnoc2N)c(O)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-6-3-7(2)10(9(14)4-6)8-5-13-15-11(8)12/h3-5,14H,12H2,1-2H3 |
| InChIKey | SPGBUGDGSJFYQL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol?
The IUPAC name of 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol (CID 117292479) is 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol.
What is the SMILES notation for 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol?
The canonical SMILES for 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol is Cc1cc(C)c(-c2cnoc2N)c(O)c1.
What is the InChIKey of 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol?
The InChIKey is SPGBUGDGSJFYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-6-3-7(2)10(9(14)4-6)8-5-13-15-11(8)12/h3-5,14H,12H2,1-2H3.
What are the key properties of 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol?
2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol has a molecular weight of 204.23 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-1,2-oxazol-4-yl)-3,5-dimethylphenol is sourced from PubChem (CID 117292479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).