C11H12N2O2 — CID 117292521
O-[[4-(4-methyl-1,3-oxazol-2-yl)phenyl]methyl]hydroxylamine (PubChem CID 117292521) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is O-[[4-(4-methyl-1,3-oxazol-2-yl)phenyl]methyl]hydroxylamine.
| Compound Name | O-[[4-(4-methyl-1,3-oxazol-2-yl)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117292521 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | O-[[4-(4-methyl-1,3-oxazol-2-yl)phenyl]methyl]hydroxylamine |
| SMILES | Cc1coc(-c2ccc(CON)cc2)n1 |
| InChI | InChI=1S/C11H12N2O2/c1-8-6-14-11(13-8)10-4-2-9(3-5-10)7-15-12/h2-6H,7,12H2,1H3 |
| InChIKey | AOLFGIJQXFKOFO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|