About (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine
(E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine (PubChem CID 117292867) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine |
| PubChem CID | 117292867 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine |
| SMILES | Cc1nsc2cc(/C=C/CN)ccc12 |
| InChI | InChI=1S/C11H12N2S/c1-8-10-5-4-9(3-2-6-12)7-11(10)14-13-8/h2-5,7H,6,12H2,1H3/b3-2+ |
| InChIKey | MUFQFCKUBLAZJA-NSCUHMNNSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine?
The IUPAC name of (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine (CID 117292867) is (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine.
What is the SMILES notation for (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine?
The canonical SMILES for (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine is Cc1nsc2cc(/C=C/CN)ccc12.
What is the InChIKey of (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine?
The InChIKey is MUFQFCKUBLAZJA-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H12N2S/c1-8-10-5-4-9(3-2-6-12)7-11(10)14-13-8/h2-5,7H,6,12H2,1H3/b3-2+.
What are the key properties of (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine?
(E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine has a molecular weight of 204.30 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-methyl-1,2-benzothiazol-6-yl)prop-2-en-1-amine is sourced from PubChem (CID 117292867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).