About 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol
2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol (PubChem CID 117294166) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol |
| PubChem CID | 117294166 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol |
| SMILES | CN1CCc2ccc(C(C)(C)CO)cc21 |
| InChI | InChI=1S/C13H19NO/c1-13(2,9-15)11-5-4-10-6-7-14(3)12(10)8-11/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | ZWOAJKRPAIVDSS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol?
The IUPAC name of 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol (CID 117294166) is 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol.
What is the SMILES notation for 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol?
The canonical SMILES for 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol is CN1CCc2ccc(C(C)(C)CO)cc21.
What is the InChIKey of 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol?
The InChIKey is ZWOAJKRPAIVDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-13(2,9-15)11-5-4-10-6-7-14(3)12(10)8-11/h4-5,8,15H,6-7,9H2,1-3H3.
What are the key properties of 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol?
2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol has a molecular weight of 205.30 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(1-methyl-2,3-dihydroindol-6-yl)propan-1-ol is sourced from PubChem (CID 117294166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).