C24H42O4Si — CID 11729526
(1S,5R,9S,13R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3,6,10,10,13-hexamethyl-2,4-dioxatricyclo[7.3.1.05,13]tridec-6-en-8-one (PubChem CID 11729526) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (1S,5R,9S,13R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3,6,10,10,13-hexamethyl-2,4-dioxatricyclo[7.3.1.05,13]tridec-6-en-8-one.
| Compound Name | (1S,5R,9S,13R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3,6,10,10,13-hexamethyl-2,4-dioxatricyclo[7.3.1.05,13]tridec-6-en-8-one |
|---|---|
| PubChem CID | 11729526 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (1S,5R,9S,13R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3,6,10,10,13-hexamethyl-2,4-dioxatricyclo[7.3.1.05,13]tridec-6-en-8-one |
| SMILES | CC1=CC(=O)[C@H]2C(C)(C)CC[C@@H]3OC(C)(C)O[C@@]1(CO[Si](C)(C)C(C)(C)C)[C@@]32C |
| InChI | InChI=1S/C24H42O4Si/c1-16-14-17(25)19-21(5,6)13-12-18-23(19,9)24(16,28-22(7,8)27-18)15-26-29(10,11)20(2,3)4/h14,18-19H,12-13,15H2,1-11H3/t18-,19-,23-,24+/m0/s1 |
| InChIKey | TZCDHNAAEUBGOM-CVKIWWORSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|