C10H9NO4 — CID 117295438
4-(isocyanatomethyl)-6-methoxy-1,3-benzodioxole (PubChem CID 117295438) has the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. Its IUPAC name is 4-(isocyanatomethyl)-6-methoxy-1,3-benzodioxole.
| Compound Name | 4-(isocyanatomethyl)-6-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 117295438 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-(isocyanatomethyl)-6-methoxy-1,3-benzodioxole |
| SMILES | COc1cc(CN=C=O)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H9NO4/c1-13-8-2-7(4-11-5-12)10-9(3-8)14-6-15-10/h2-3H,4,6H2,1H3 |
| InChIKey | NJXFIGYLOJPBJZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|