C12H17NO2 — CID 117296163
2-(1-aminocyclopropyl)-6-methoxy-3,4-dimethylphenol (PubChem CID 117296163) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(1-aminocyclopropyl)-6-methoxy-3,4-dimethylphenol.
| Compound Name | 2-(1-aminocyclopropyl)-6-methoxy-3,4-dimethylphenol |
|---|---|
| PubChem CID | 117296163 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(1-aminocyclopropyl)-6-methoxy-3,4-dimethylphenol |
| SMILES | COc1cc(C)c(C)c(C2(N)CC2)c1O |
| InChI | InChI=1S/C12H17NO2/c1-7-6-9(15-3)11(14)10(8(7)2)12(13)4-5-12/h6,14H,4-5,13H2,1-3H3 |
| InChIKey | KUANMGKWRWZQCH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|