C14H26N8O3 — CID 11729620
(3S)-3-amino-6-(1-aminoethylideneamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide (PubChem CID 11729620) has the molecular formula C14H26N8O3 and a molecular weight of 354.42 g/mol. Its IUPAC name is (3S)-3-amino-6-(1-aminoethylideneamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide.
| Compound Name | (3S)-3-amino-6-(1-aminoethylideneamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide |
|---|---|
| PubChem CID | 11729620 |
| Molecular Formula | C14H26N8O3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3S)-3-amino-6-(1-aminoethylideneamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide |
| SMILES | C/C(N)=N\CCC[C@H](N)CC(=O)N(C)C1CN=C(NC(N)=O)NC1=O |
| InChI | InChI=1S/C14H26N8O3/c1-8(15)18-5-3-4-9(16)6-11(23)22(2)10-7-19-14(20-12(10)24)21-13(17)25/h9-10H,3-7,16H2,1-2H3,(H2,15,18)(H4,17,19,20,21,24,25)/t9-,10?/m0/s1 |
| InChIKey | HLRHTGRTGIWXRE-RGURZIINSA-N |
| XLogP | -2.16 |
| TPSA | 181.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|