C27H25NO4 — CID 11729623
(3-benzylphenyl)-[8-(2-methoxyethoxymethoxy)quinolin-7-yl]methanone (PubChem CID 11729623) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3-benzylphenyl)-[8-(2-methoxyethoxymethoxy)quinolin-7-yl]methanone.
| Compound Name | (3-benzylphenyl)-[8-(2-methoxyethoxymethoxy)quinolin-7-yl]methanone |
|---|---|
| PubChem CID | 11729623 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (3-benzylphenyl)-[8-(2-methoxyethoxymethoxy)quinolin-7-yl]methanone |
| SMILES | COCCOCOc1c(C(=O)c2cccc(Cc3ccccc3)c2)ccc2cccnc12 |
| InChI | InChI=1S/C27H25NO4/c1-30-15-16-31-19-32-27-24(13-12-22-11-6-14-28-25(22)27)26(29)23-10-5-9-21(18-23)17-20-7-3-2-4-8-20/h2-14,18H,15-17,19H2,1H3 |
| InChIKey | SBYDRUOIHCMANZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|