C12H17NO2 — CID 117296327
1-[2-(cyclopropylmethoxy)phenyl]-N-methoxymethanamine (PubChem CID 117296327) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)phenyl]-N-methoxymethanamine.
| Compound Name | 1-[2-(cyclopropylmethoxy)phenyl]-N-methoxymethanamine |
|---|---|
| PubChem CID | 117296327 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)phenyl]-N-methoxymethanamine |
| SMILES | CONCc1ccccc1OCC1CC1 |
| InChI | InChI=1S/C12H17NO2/c1-14-13-8-11-4-2-3-5-12(11)15-9-10-6-7-10/h2-5,10,13H,6-9H2,1H3 |
| InChIKey | RDNBNAVGLFDATB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|