C25H36O4Si — CID 11729646
4-[4-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethoxynaphthalen-2-yl]hepta-1,6-dien-4-ol (PubChem CID 11729646) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is 4-[4-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethoxynaphthalen-2-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethoxynaphthalen-2-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 11729646 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethoxynaphthalen-2-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)c1cc(O[Si](C)(C)C(C)(C)C)c2c(OC)ccc(OC)c2c1 |
| InChI | InChI=1S/C25H36O4Si/c1-10-14-25(26,15-11-2)18-16-19-20(27-6)12-13-21(28-7)23(19)22(17-18)29-30(8,9)24(3,4)5/h10-13,16-17,26H,1-2,14-15H2,3-9H3 |
| InChIKey | NWSZNUAYSFJKQR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|