C22H46O4Si2 — CID 11729683
3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propan-1-ol (PubChem CID 11729683) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11729683 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propan-1-ol |
| SMILES | C=CC[C@H]1O[C@@H](CCCO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4Si2/c1-12-14-17-19(25-27(8,9)21(2,3)4)20(18(24-17)15-13-16-23)26-28(10,11)22(5,6)7/h12,17-20,23H,1,13-16H2,2-11H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | LYUYAMSBVJEWEW-IYWMVGAKSA-N |
| XLogP | 5.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|