C19H29NO10 — CID 11729689
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[acetyl(propyl)amino]oxan-2-yl]methyl acetate (PubChem CID 11729689) has the molecular formula C19H29NO10 and a molecular weight of 431.44 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[acetyl(propyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[acetyl(propyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11729689 |
| Molecular Formula | C19H29NO10 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[acetyl(propyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CCCN(C(C)=O)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H29NO10/c1-7-8-20(10(2)21)19-18(29-14(6)25)17(28-13(5)24)16(27-12(4)23)15(30-19)9-26-11(3)22/h15-19H,7-9H2,1-6H3/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | DSLCQIQRLCOINZ-UJWQCDCRSA-N |
| XLogP | 0.33 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|