C20H15ClF5NO2 — CID 11729707
ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1-carboxylate (PubChem CID 11729707) has the molecular formula C20H15ClF5NO2 and a molecular weight of 431.79 g/mol. Its IUPAC name is ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1-carboxylate.
| Compound Name | ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1-carboxylate |
|---|---|
| PubChem CID | 11729707 |
| Molecular Formula | C20H15ClF5NO2 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)C(F)(F)C(F)(F)Cl)c(-c2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C20H15ClF5NO2/c1-2-29-18(28)14-13-10-6-7-11-27(13)16(12-8-4-3-5-9-12)15(14)17(22)19(23,24)20(21,25)26/h3-11,17H,2H2,1H3 |
| InChIKey | QURZQXIMGKBZTQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|